C18H24NaO3S — CID 87495207
CID 87495207 (PubChem CID 87495207) has the molecular formula C18H24NaO3S and a molecular weight of 343.44 g/mol.
| Compound Name | CID 87495207 |
|---|---|
| PubChem CID | 87495207 |
| Molecular Formula | C18H24NaO3S |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | — |
| SMILES | CCCCCCCCc1ccc2ccccc2c1S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C18H24O3S.Na/c1-2-3-4-5-6-7-11-16-14-13-15-10-8-9-12-17(15)18(16)22(19,20)21;/h8-10,12-14H,2-7,11H2,1H3,(H,19,20,21); |
| InChIKey | UBVOTNGBFQTUNN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|