C23H34O3S2 — CID 159291127
2-decylnaphthalene-1-sulfonic acid;prop-1-ene-1-thiol (PubChem CID 159291127) has the molecular formula C23H34O3S2 and a molecular weight of 422.66 g/mol. Its IUPAC name is 2-decylnaphthalene-1-sulfonic acid;prop-1-ene-1-thiol.
| Compound Name | 2-decylnaphthalene-1-sulfonic acid;prop-1-ene-1-thiol |
|---|---|
| PubChem CID | 159291127 |
| Molecular Formula | C23H34O3S2 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-decylnaphthalene-1-sulfonic acid;prop-1-ene-1-thiol |
| SMILES | CC=CS.CCCCCCCCCCc1ccc2ccccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C20H28O3S.C3H6S/c1-2-3-4-5-6-7-8-9-13-18-16-15-17-12-10-11-14-19(17)20(18)24(21,22)23;1-2-3-4/h10-12,14-16H,2-9,13H2,1H3,(H,21,22,23);2-4H,1H3 |
| InChIKey | LADDXCOZRRAJSF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|