C28H44O6S2 — CID 57358299
2,6-di(nonyl)naphthalene-1,5-disulfonic acid (PubChem CID 57358299) has the molecular formula C28H44O6S2 and a molecular weight of 540.79 g/mol. Its IUPAC name is 2,6-di(nonyl)naphthalene-1,5-disulfonic acid.
| Compound Name | 2,6-di(nonyl)naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 57358299 |
| Molecular Formula | C28H44O6S2 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 2,6-di(nonyl)naphthalene-1,5-disulfonic acid |
| SMILES | CCCCCCCCCc1ccc2c(S(=O)(=O)O)c(CCCCCCCCC)ccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C28H44O6S2/c1-3-5-7-9-11-13-15-17-23-19-21-26-25(27(23)35(29,30)31)22-20-24(28(26)36(32,33)34)18-16-14-12-10-8-6-4-2/h19-22H,3-18H2,1-2H3,(H,29,30,31)(H,32,33,34) |
| InChIKey | KVOYCYJHAKSFSR-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|