C19H26O3S — CID 87211410
2-(4-methylpentyl)-3-propan-2-ylnaphthalene-1-sulfonic acid (PubChem CID 87211410) has the molecular formula C19H26O3S and a molecular weight of 334.48 g/mol. Its IUPAC name is 2-(4-methylpentyl)-3-propan-2-ylnaphthalene-1-sulfonic acid.
| Compound Name | 2-(4-methylpentyl)-3-propan-2-ylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 87211410 |
| Molecular Formula | C19H26O3S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-(4-methylpentyl)-3-propan-2-ylnaphthalene-1-sulfonic acid |
| SMILES | CC(C)CCCc1c(C(C)C)cc2ccccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C19H26O3S/c1-13(2)8-7-11-17-18(14(3)4)12-15-9-5-6-10-16(15)19(17)23(20,21)22/h5-6,9-10,12-14H,7-8,11H2,1-4H3,(H,20,21,22) |
| InChIKey | HWZNHSGSUFEMHS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|