C21H30 — CID 154241338
1,2-dibutyl-3-propan-2-ylnaphthalene (PubChem CID 154241338) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 1,2-dibutyl-3-propan-2-ylnaphthalene.
| Compound Name | 1,2-dibutyl-3-propan-2-ylnaphthalene |
|---|---|
| PubChem CID | 154241338 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1,2-dibutyl-3-propan-2-ylnaphthalene |
| SMILES | CCCCc1c(C(C)C)cc2ccccc2c1CCCC |
| InChI | InChI=1S/C21H30/c1-5-7-12-19-18-14-10-9-11-17(18)15-21(16(3)4)20(19)13-8-6-2/h9-11,14-16H,5-8,12-13H2,1-4H3 |
| InChIKey | GSMNNVFIAVPTHQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |