C26H28O4 — CID 67610713
1-butylnaphthalene-2,3-diol;1,4-dimethylnaphthalene-2,3-diol (PubChem CID 67610713) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-butylnaphthalene-2,3-diol;1,4-dimethylnaphthalene-2,3-diol.
| Compound Name | 1-butylnaphthalene-2,3-diol;1,4-dimethylnaphthalene-2,3-diol |
|---|---|
| PubChem CID | 67610713 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-butylnaphthalene-2,3-diol;1,4-dimethylnaphthalene-2,3-diol |
| SMILES | CCCCc1c(O)c(O)cc2ccccc12.Cc1c(O)c(O)c(C)c2ccccc12 |
| InChI | InChI=1S/C14H16O2.C12H12O2/c1-2-3-7-12-11-8-5-4-6-10(11)9-13(15)14(12)16;1-7-9-5-3-4-6-10(9)8(2)12(14)11(7)13/h4-6,8-9,15-16H,2-3,7H2,1H3;3-6,13-14H,1-2H3 |
| InChIKey | POMBQYNOELZXNG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|