C15H18O2 — CID 14529620
3-pentylnaphthalene-1,2-diol (PubChem CID 14529620) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-pentylnaphthalene-1,2-diol.
| Compound Name | 3-pentylnaphthalene-1,2-diol |
|---|---|
| PubChem CID | 14529620 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3-pentylnaphthalene-1,2-diol |
| SMILES | CCCCCc1cc2ccccc2c(O)c1O |
| InChI | InChI=1S/C15H18O2/c1-2-3-4-8-12-10-11-7-5-6-9-13(11)15(17)14(12)16/h5-7,9-10,16-17H,2-4,8H2,1H3 |
| InChIKey | USTZRBDAIKKMMV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|