C74H122BaO6S2 — CID 141384141
barium(2+);bis(2,3,4-tri(nonyl)naphthalene-1-sulfonate) (PubChem CID 141384141) has the molecular formula C74H122BaO6S2 and a molecular weight of 1309.25 g/mol. Its IUPAC name is barium(2+);bis(2,3,4-tri(nonyl)naphthalene-1-sulfonate).
| Compound Name | barium(2+);bis(2,3,4-tri(nonyl)naphthalene-1-sulfonate) |
|---|---|
| PubChem CID | 141384141 |
| Molecular Formula | C74H122BaO6S2 |
| Molecular Weight | 1309.25 g/mol |
| Exact Mass | 1308.77 |
| IUPAC Name | barium(2+);bis(2,3,4-tri(nonyl)naphthalene-1-sulfonate) |
| SMILES | CCCCCCCCCc1c(CCCCCCCCC)c(S(=O)(=O)[O-])c2ccccc2c1CCCCCCCCC.CCCCCCCCCc1c(CCCCCCCCC)c(S(=O)(=O)[O-])c2ccccc2c1CCCCCCCCC.[Ba+2] |
| InChI | InChI=1S/2C37H62O3S.Ba/c2*1-4-7-10-13-16-19-22-27-32-33(28-23-20-17-14-11-8-5-2)35(30-24-21-18-15-12-9-6-3)37(41(38,39)40)36-31-26-25-29-34(32)36;/h2*25-26,29,31H,4-24,27-28,30H2,1-3H3,(H,38,39,40);/q;;+2/p-2 |
| InChIKey | ICJWDDWHUKHKNA-UHFFFAOYSA-L |
| XLogP | 22.87 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1309.25 |
| LogP ≤ 5 | 22.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|