C48H70BaO6S2 — CID 101318938
barium(2+);bis(2,4-diheptylnaphthalene-1-sulfonate) (PubChem CID 101318938) has the molecular formula C48H70BaO6S2 and a molecular weight of 944.54 g/mol. Its IUPAC name is barium(2+);bis(2,4-diheptylnaphthalene-1-sulfonate).
| Compound Name | barium(2+);bis(2,4-diheptylnaphthalene-1-sulfonate) |
|---|---|
| PubChem CID | 101318938 |
| Molecular Formula | C48H70BaO6S2 |
| Molecular Weight | 944.54 g/mol |
| Exact Mass | 944.37 |
| IUPAC Name | barium(2+);bis(2,4-diheptylnaphthalene-1-sulfonate) |
| SMILES | CCCCCCCc1cc(CCCCCCC)c2ccccc2c1S(=O)(=O)[O-].CCCCCCCc1cc(CCCCCCC)c2ccccc2c1S(=O)(=O)[O-].[Ba+2] |
| InChI | InChI=1S/2C24H36O3S.Ba/c2*1-3-5-7-9-11-15-20-19-21(16-12-10-8-6-4-2)24(28(25,26)27)23-18-14-13-17-22(20)23;/h2*13-14,17-19H,3-12,15-16H2,1-2H3,(H,25,26,27);/q;;+2/p-2 |
| InChIKey | LZMFDEACOLFIIE-UHFFFAOYSA-L |
| XLogP | 13.16 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.54 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|