C54H68O8S2 — CID 88699384
3,4-dioctylnaphthalene-1,2-disulfonic acid;phenylmethoxymethylbenzene (PubChem CID 88699384) has the molecular formula C54H68O8S2 and a molecular weight of 909.26 g/mol. Its IUPAC name is 3,4-dioctylnaphthalene-1,2-disulfonic acid;phenylmethoxymethylbenzene.
| Compound Name | 3,4-dioctylnaphthalene-1,2-disulfonic acid;phenylmethoxymethylbenzene |
|---|---|
| PubChem CID | 88699384 |
| Molecular Formula | C54H68O8S2 |
| Molecular Weight | 909.26 g/mol |
| Exact Mass | 908.44 |
| IUPAC Name | 3,4-dioctylnaphthalene-1,2-disulfonic acid;phenylmethoxymethylbenzene |
| SMILES | CCCCCCCCc1c(S(=O)(=O)O)c(S(=O)(=O)O)c2ccccc2c1CCCCCCCC.c1ccc(COCc2ccccc2)cc1.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H40O6S2.2C14H14O/c1-3-5-7-9-11-13-17-21-22-18-15-16-20-24(22)26(34(30,31)32)25(33(27,28)29)23(21)19-14-12-10-8-6-4-2;2*1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14/h15-16,18,20H,3-14,17,19H2,1-2H3,(H,27,28,29)(H,30,31,32);2*1-10H,11-12H2 |
| InChIKey | USZOGKGMRZGBJV-UHFFFAOYSA-N |
| XLogP | 13.95 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.26 |
| LogP ≤ 5 | 13.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|