C27H36O7S — CID 150996195
2,4-dibutyl-6-(5-phenylpentyl)-5-sulfobenzene-1,3-dicarboxylic acid (PubChem CID 150996195) has the molecular formula C27H36O7S and a molecular weight of 504.65 g/mol. Its IUPAC name is 2,4-dibutyl-6-(5-phenylpentyl)-5-sulfobenzene-1,3-dicarboxylic acid.
| Compound Name | 2,4-dibutyl-6-(5-phenylpentyl)-5-sulfobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150996195 |
| Molecular Formula | C27H36O7S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 2,4-dibutyl-6-(5-phenylpentyl)-5-sulfobenzene-1,3-dicarboxylic acid |
| SMILES | CCCCc1c(C(=O)O)c(CCCC)c(S(=O)(=O)O)c(CCCCCc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C27H36O7S/c1-3-5-16-20-23(26(28)29)21(17-6-4-2)25(35(32,33)34)22(24(20)27(30)31)18-12-8-11-15-19-13-9-7-10-14-19/h7,9-10,13-14H,3-6,8,11-12,15-18H2,1-2H3,(H,28,29)(H,30,31)(H,32,33,34) |
| InChIKey | LTDJZYDMMIWXFM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|