6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid

C24H28O6 — CID 87694909

IUPAC6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid
SMILESCCCCc1c(Cc2ccccc2)c(C(=O)O)c(C(=O)O)c(CCCC)c1C(=O)O
InChIInChI=1S/C24H28O6/c1-3-5-12-16-18(14-15-10-8-7-9-11-15)21(24(29)30)20(23(27)28)17(13-6-4-2)19(16)22(25)26/h7-11H,3-6,12-14H2,1-2H3,(H,25,26)(H,27,28)(H,29,30)
InChIKeyHYLOEAUQEZJAFK-UHFFFAOYSA-N
MW412.48 g/mol
LogP5.06
Rot. Bonds11

About 6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid

6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid (PubChem CID 87694909) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is 6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid.

Molecular Properties

Compound Name6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid
PubChem CID87694909
Molecular FormulaC24H28O6
Molecular Weight412.48 g/mol
Exact Mass412.19
IUPAC Name6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid
SMILESCCCCc1c(Cc2ccccc2)c(C(=O)O)c(C(=O)O)c(CCCC)c1C(=O)O
InChIInChI=1S/C24H28O6/c1-3-5-12-16-18(14-15-10-8-7-9-11-15)21(24(29)30)20(23(27)28)17(13-6-4-2)19(16)22(25)26/h7-11H,3-6,12-14H2,1-2H3,(H,25,26)(H,27,28)(H,29,30)
InChIKeyHYLOEAUQEZJAFK-UHFFFAOYSA-N
XLogP5.06
TPSA111.90 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds11
Heavy Atoms30
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500412.48
LogP ≤ 55.06
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid?
The IUPAC name of 6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid (CID 87694909) is 6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid.
What is the SMILES notation for 6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid?
The canonical SMILES for 6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid is CCCCc1c(Cc2ccccc2)c(C(=O)O)c(C(=O)O)c(CCCC)c1C(=O)O.
What is the InChIKey of 6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid?
The InChIKey is HYLOEAUQEZJAFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O6/c1-3-5-12-16-18(14-15-10-8-7-9-11-15)21(24(29)30)20(23(27)28)17(13-6-4-2)19(16)22(25)26/h7-11H,3-6,12-14H2,1-2H3,(H,25,26)(H,27,28)(H,29,30).
What are the key properties of 6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid?
6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid has a molecular weight of 412.48 g/mol, XLogP of 5.06, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-3,5-dibutylbenzene-1,2,4-tricarboxylic acid is sourced from PubChem (CID 87694909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).