C25H34O — CID 15370927
(2-butyl-3,4,5,6-tetraethylphenyl)-phenylmethanone (PubChem CID 15370927) has the molecular formula C25H34O and a molecular weight of 350.55 g/mol. Its IUPAC name is (2-butyl-3,4,5,6-tetraethylphenyl)-phenylmethanone.
| Compound Name | (2-butyl-3,4,5,6-tetraethylphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 15370927 |
| Molecular Formula | C25H34O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (2-butyl-3,4,5,6-tetraethylphenyl)-phenylmethanone |
| SMILES | CCCCc1c(CC)c(CC)c(CC)c(CC)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H34O/c1-6-11-17-23-21(9-4)19(7-2)20(8-3)22(10-5)24(23)25(26)18-15-13-12-14-16-18/h12-16H,6-11,17H2,1-5H3 |
| InChIKey | VDYQZIPIYIELNQ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |