C20H24O4 — CID 174471855
(4-heptyl-2,3,5-trihydroxyphenyl)-phenylmethanone (PubChem CID 174471855) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (4-heptyl-2,3,5-trihydroxyphenyl)-phenylmethanone.
| Compound Name | (4-heptyl-2,3,5-trihydroxyphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 174471855 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (4-heptyl-2,3,5-trihydroxyphenyl)-phenylmethanone |
| SMILES | CCCCCCCc1c(O)cc(C(=O)c2ccccc2)c(O)c1O |
| InChI | InChI=1S/C20H24O4/c1-2-3-4-5-9-12-15-17(21)13-16(20(24)19(15)23)18(22)14-10-7-6-8-11-14/h6-8,10-11,13,21,23-24H,2-5,9,12H2,1H3 |
| InChIKey | AZLOPUYQJAAXGS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|