C29H28O6 — CID 23586585
4-benzoyl-6-(3-hexyl-4-methylbenzoyl)benzene-1,3-dicarboxylic acid (PubChem CID 23586585) has the molecular formula C29H28O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is 4-benzoyl-6-(3-hexyl-4-methylbenzoyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4-benzoyl-6-(3-hexyl-4-methylbenzoyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 23586585 |
| Molecular Formula | C29H28O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 4-benzoyl-6-(3-hexyl-4-methylbenzoyl)benzene-1,3-dicarboxylic acid |
| SMILES | CCCCCCc1cc(C(=O)c2cc(C(=O)c3ccccc3)c(C(=O)O)cc2C(=O)O)ccc1C |
| InChI | InChI=1S/C29H28O6/c1-3-4-5-7-12-20-15-21(14-13-18(20)2)27(31)23-16-22(26(30)19-10-8-6-9-11-19)24(28(32)33)17-25(23)29(34)35/h6,8-11,13-17H,3-5,7,12H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | DHFNMDCQWYBIAS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|