4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid

C23H16O6 — CID 23586588

IUPAC4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid
SMILESCc1ccc(C(=O)c2cc(C(=O)c3ccccc3)c(C(=O)O)cc2C(=O)O)cc1
InChIInChI=1S/C23H16O6/c1-13-7-9-15(10-8-13)21(25)17-11-16(20(24)14-5-3-2-4-6-14)18(22(26)27)12-19(17)23(28)29/h2-12H,1H3,(H,26,27)(H,28,29)
InChIKeyKKZDKNOJPDXKRZ-UHFFFAOYSA-N
MW388.38 g/mol
LogP3.85
Rot. Bonds6

About 4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid

4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid (PubChem CID 23586588) has the molecular formula C23H16O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is 4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid
PubChem CID23586588
Molecular FormulaC23H16O6
Molecular Weight388.38 g/mol
Exact Mass388.09
IUPAC Name4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid
SMILESCc1ccc(C(=O)c2cc(C(=O)c3ccccc3)c(C(=O)O)cc2C(=O)O)cc1
InChIInChI=1S/C23H16O6/c1-13-7-9-15(10-8-13)21(25)17-11-16(20(24)14-5-3-2-4-6-14)18(22(26)27)12-19(17)23(28)29/h2-12H,1H3,(H,26,27)(H,28,29)
InChIKeyKKZDKNOJPDXKRZ-UHFFFAOYSA-N
XLogP3.85
TPSA108.74 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500388.38
LogP ≤ 53.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid?
The IUPAC name of 4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid (CID 23586588) is 4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid is Cc1ccc(C(=O)c2cc(C(=O)c3ccccc3)c(C(=O)O)cc2C(=O)O)cc1.
What is the InChIKey of 4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid?
The InChIKey is KKZDKNOJPDXKRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16O6/c1-13-7-9-15(10-8-13)21(25)17-11-16(20(24)14-5-3-2-4-6-14)18(22(26)27)12-19(17)23(28)29/h2-12H,1H3,(H,26,27)(H,28,29).
What are the key properties of 4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid?
4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid has a molecular weight of 388.38 g/mol, XLogP of 3.85, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzoyl-6-(4-methylbenzoyl)benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 23586588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).