C26H26O4 — CID 516965
(3-benzoyl-5-hexyl-2,4-dihydroxyphenyl)-phenylmethanone (PubChem CID 516965) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is (3-benzoyl-5-hexyl-2,4-dihydroxyphenyl)-phenylmethanone.
| Compound Name | (3-benzoyl-5-hexyl-2,4-dihydroxyphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 516965 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (3-benzoyl-5-hexyl-2,4-dihydroxyphenyl)-phenylmethanone |
| SMILES | CCCCCCc1cc(C(=O)c2ccccc2)c(O)c(C(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C26H26O4/c1-2-3-4-7-16-20-17-21(23(27)18-12-8-5-9-13-18)26(30)22(25(20)29)24(28)19-14-10-6-11-15-19/h5-6,8-15,17,29-30H,2-4,7,16H2,1H3 |
| InChIKey | LGOMKSQEZOHEAQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|