C21H26O3 — CID 23109188
(3,5-dibutyl-2,4-dihydroxyphenyl)-phenylmethanone (PubChem CID 23109188) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (3,5-dibutyl-2,4-dihydroxyphenyl)-phenylmethanone.
| Compound Name | (3,5-dibutyl-2,4-dihydroxyphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 23109188 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (3,5-dibutyl-2,4-dihydroxyphenyl)-phenylmethanone |
| SMILES | CCCCc1cc(C(=O)c2ccccc2)c(O)c(CCCC)c1O |
| InChI | InChI=1S/C21H26O3/c1-3-5-10-16-14-18(19(22)15-11-8-7-9-12-15)21(24)17(20(16)23)13-6-4-2/h7-9,11-12,14,23-24H,3-6,10,13H2,1-2H3 |
| InChIKey | IUFDARGJFIJOLT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |