C25H34O — CID 134864036
phenyl-(2,3,4,5-tetrapropylphenyl)methanone (PubChem CID 134864036) has the molecular formula C25H34O and a molecular weight of 350.55 g/mol. Its IUPAC name is phenyl-(2,3,4,5-tetrapropylphenyl)methanone.
| Compound Name | phenyl-(2,3,4,5-tetrapropylphenyl)methanone |
|---|---|
| PubChem CID | 134864036 |
| Molecular Formula | C25H34O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | phenyl-(2,3,4,5-tetrapropylphenyl)methanone |
| SMILES | CCCc1cc(C(=O)c2ccccc2)c(CCC)c(CCC)c1CCC |
| InChI | InChI=1S/C25H34O/c1-5-12-20-18-24(25(26)19-16-10-9-11-17-19)23(15-8-4)22(14-7-3)21(20)13-6-2/h9-11,16-18H,5-8,12-15H2,1-4H3 |
| InChIKey | FSRVHOZHXGBTKE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |