C21H26O — CID 154224122
(2,4-dibutylphenyl)-phenylmethanone (PubChem CID 154224122) has the molecular formula C21H26O and a molecular weight of 294.44 g/mol. Its IUPAC name is (2,4-dibutylphenyl)-phenylmethanone.
| Compound Name | (2,4-dibutylphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 154224122 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (2,4-dibutylphenyl)-phenylmethanone |
| SMILES | CCCCc1ccc(C(=O)c2ccccc2)c(CCCC)c1 |
| InChI | InChI=1S/C21H26O/c1-3-5-10-17-14-15-20(19(16-17)11-6-4-2)21(22)18-12-8-7-9-13-18/h7-9,12-16H,3-6,10-11H2,1-2H3 |
| InChIKey | BGTJKBRBOYHAFM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |