C21H26O3 — CID 58352220
[4-(4-butoxybutyl)-2-hydroxyphenyl]-phenylmethanone (PubChem CID 58352220) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is [4-(4-butoxybutyl)-2-hydroxyphenyl]-phenylmethanone.
| Compound Name | [4-(4-butoxybutyl)-2-hydroxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 58352220 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [4-(4-butoxybutyl)-2-hydroxyphenyl]-phenylmethanone |
| SMILES | CCCCOCCCCc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C21H26O3/c1-2-3-14-24-15-8-7-9-17-12-13-19(20(22)16-17)21(23)18-10-5-4-6-11-18/h4-6,10-13,16,22H,2-3,7-9,14-15H2,1H3 |
| InChIKey | FODBZZRFAJALBO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|