C29H31N3O4 — CID 143289929
[4-[4-(4-amino-3-hydroxyphenyl)butoxy]-2-hydroxyphenyl]-phenylmethanone;benzene-1,2-diamine (PubChem CID 143289929) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is [4-[4-(4-amino-3-hydroxyphenyl)butoxy]-2-hydroxyphenyl]-phenylmethanone;benzene-1,2-diamine.
| Compound Name | [4-[4-(4-amino-3-hydroxyphenyl)butoxy]-2-hydroxyphenyl]-phenylmethanone;benzene-1,2-diamine |
|---|---|
| PubChem CID | 143289929 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | [4-[4-(4-amino-3-hydroxyphenyl)butoxy]-2-hydroxyphenyl]-phenylmethanone;benzene-1,2-diamine |
| SMILES | Nc1ccc(CCCCOc2ccc(C(=O)c3ccccc3)c(O)c2)cc1O.Nc1ccccc1N |
| InChI | InChI=1S/C23H23NO4.C6H8N2/c24-20-12-9-16(14-22(20)26)6-4-5-13-28-18-10-11-19(21(25)15-18)23(27)17-7-2-1-3-8-17;7-5-3-1-2-4-6(5)8/h1-3,7-12,14-15,25-26H,4-6,13,24H2;1-4H,7-8H2 |
| InChIKey | RUGIEKZMZIIYPV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 144.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|