C30H28O5 — CID 58175145
[4-[4-(4-benzyl-3-hydroxyphenoxy)butoxy]-2-hydroxyphenyl]-phenylmethanone (PubChem CID 58175145) has the molecular formula C30H28O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is [4-[4-(4-benzyl-3-hydroxyphenoxy)butoxy]-2-hydroxyphenyl]-phenylmethanone.
| Compound Name | [4-[4-(4-benzyl-3-hydroxyphenoxy)butoxy]-2-hydroxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 58175145 |
| Molecular Formula | C30H28O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | [4-[4-(4-benzyl-3-hydroxyphenoxy)butoxy]-2-hydroxyphenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(OCCCCOc2ccc(Cc3ccccc3)c(O)c2)cc1O |
| InChI | InChI=1S/C30H28O5/c31-28-20-25(14-13-24(28)19-22-9-3-1-4-10-22)34-17-7-8-18-35-26-15-16-27(29(32)21-26)30(33)23-11-5-2-6-12-23/h1-6,9-16,20-21,31-32H,7-8,17-19H2 |
| InChIKey | WMMFZIONERHAPJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|