C23H23NO5 — CID 67587668
1-[6-(4-benzoyl-3-hydroxyphenoxy)hexyl]pyrrole-2,5-dione (PubChem CID 67587668) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-[6-(4-benzoyl-3-hydroxyphenoxy)hexyl]pyrrole-2,5-dione.
| Compound Name | 1-[6-(4-benzoyl-3-hydroxyphenoxy)hexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67587668 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-[6-(4-benzoyl-3-hydroxyphenoxy)hexyl]pyrrole-2,5-dione |
| SMILES | O=C(c1ccccc1)c1ccc(OCCCCCCN2C(=O)C=CC2=O)cc1O |
| InChI | InChI=1S/C23H23NO5/c25-20-16-18(10-11-19(20)23(28)17-8-4-3-5-9-17)29-15-7-2-1-6-14-24-21(26)12-13-22(24)27/h3-5,8-13,16,25H,1-2,6-7,14-15H2 |
| InChIKey | KKPPRXPLKGMUFW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|