C22H30O5 — CID 162734558
ethoxyethane;[4-(3-ethoxypropoxy)-2-hydroxyphenyl]-phenylmethanone (PubChem CID 162734558) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is ethoxyethane;[4-(3-ethoxypropoxy)-2-hydroxyphenyl]-phenylmethanone.
| Compound Name | ethoxyethane;[4-(3-ethoxypropoxy)-2-hydroxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 162734558 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | ethoxyethane;[4-(3-ethoxypropoxy)-2-hydroxyphenyl]-phenylmethanone |
| SMILES | CCOCC.CCOCCCOc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C18H20O4.C4H10O/c1-2-21-11-6-12-22-15-9-10-16(17(19)13-15)18(20)14-7-4-3-5-8-14;1-3-5-4-2/h3-5,7-10,13,19H,2,6,11-12H2,1H3;3-4H2,1-2H3 |
| InChIKey | BAHHCXVOYLOZKM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|