C25H27NO4 — CID 18006890
(4-butyl-2-hydroxyphenyl)-phenylmethanone;(2-methylphenyl)carbamic acid (PubChem CID 18006890) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is (4-butyl-2-hydroxyphenyl)-phenylmethanone;(2-methylphenyl)carbamic acid.
| Compound Name | (4-butyl-2-hydroxyphenyl)-phenylmethanone;(2-methylphenyl)carbamic acid |
|---|---|
| PubChem CID | 18006890 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (4-butyl-2-hydroxyphenyl)-phenylmethanone;(2-methylphenyl)carbamic acid |
| SMILES | CCCCc1ccc(C(=O)c2ccccc2)c(O)c1.Cc1ccccc1NC(=O)O |
| InChI | InChI=1S/C17H18O2.C8H9NO2/c1-2-3-7-13-10-11-15(16(18)12-13)17(19)14-8-5-4-6-9-14;1-6-4-2-3-5-7(6)9-8(10)11/h4-6,8-12,18H,2-3,7H2,1H3;2-5,9H,1H3,(H,10,11) |
| InChIKey | ZFAJNCOYYQAGIZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |