C34H44N2O4 — CID 101305952
5-heptyl-N-[2-[(5-heptyl-2-hydroxybenzoyl)amino]phenyl]-2-hydroxybenzamide (PubChem CID 101305952) has the molecular formula C34H44N2O4 and a molecular weight of 544.74 g/mol. Its IUPAC name is 5-heptyl-N-[2-[(5-heptyl-2-hydroxybenzoyl)amino]phenyl]-2-hydroxybenzamide.
| Compound Name | 5-heptyl-N-[2-[(5-heptyl-2-hydroxybenzoyl)amino]phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 101305952 |
| Molecular Formula | C34H44N2O4 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 5-heptyl-N-[2-[(5-heptyl-2-hydroxybenzoyl)amino]phenyl]-2-hydroxybenzamide |
| SMILES | CCCCCCCc1ccc(O)c(C(=O)Nc2ccccc2NC(=O)c2cc(CCCCCCC)ccc2O)c1 |
| InChI | InChI=1S/C34H44N2O4/c1-3-5-7-9-11-15-25-19-21-31(37)27(23-25)33(39)35-29-17-13-14-18-30(29)36-34(40)28-24-26(20-22-32(28)38)16-12-10-8-6-4-2/h13-14,17-24,37-38H,3-12,15-16H2,1-2H3,(H,35,39)(H,36,40) |
| InChIKey | STWGMWXRCPKQEW-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|