C21H24INO — CID 71500524
N-(2-ethenyl-4-hexylphenyl)-2-iodobenzamide (PubChem CID 71500524) has the molecular formula C21H24INO and a molecular weight of 433.33 g/mol. Its IUPAC name is N-(2-ethenyl-4-hexylphenyl)-2-iodobenzamide.
| Compound Name | N-(2-ethenyl-4-hexylphenyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 71500524 |
| Molecular Formula | C21H24INO |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-(2-ethenyl-4-hexylphenyl)-2-iodobenzamide |
| SMILES | C=Cc1cc(CCCCCC)ccc1NC(=O)c1ccccc1I |
| InChI | InChI=1S/C21H24INO/c1-3-5-6-7-10-16-13-14-20(17(4-2)15-16)23-21(24)18-11-8-9-12-19(18)22/h4,8-9,11-15H,2-3,5-7,10H2,1H3,(H,23,24) |
| InChIKey | BUTISCMOILPDCB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|