C29H20I2N2O6 — CID 3118187
5-[[3-carboxy-4-[(2-iodobenzoyl)amino]phenyl]methyl]-2-[(2-iodobenzoyl)amino]benzoic acid (PubChem CID 3118187) has the molecular formula C29H20I2N2O6 and a molecular weight of 746.30 g/mol. Its IUPAC name is 5-[[3-carboxy-4-[(2-iodobenzoyl)amino]phenyl]methyl]-2-[(2-iodobenzoyl)amino]benzoic acid.
| Compound Name | 5-[[3-carboxy-4-[(2-iodobenzoyl)amino]phenyl]methyl]-2-[(2-iodobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 3118187 |
| Molecular Formula | C29H20I2N2O6 |
| Molecular Weight | 746.30 g/mol |
| Exact Mass | 745.94 |
| IUPAC Name | 5-[[3-carboxy-4-[(2-iodobenzoyl)amino]phenyl]methyl]-2-[(2-iodobenzoyl)amino]benzoic acid |
| SMILES | O=C(Nc1ccc(Cc2ccc(NC(=O)c3ccccc3I)c(C(=O)O)c2)cc1C(=O)O)c1ccccc1I |
| InChI | InChI=1S/C29H20I2N2O6/c30-22-7-3-1-5-18(22)26(34)32-24-11-9-16(14-20(24)28(36)37)13-17-10-12-25(21(15-17)29(38)39)33-27(35)19-6-2-4-8-23(19)31/h1-12,14-15H,13H2,(H,32,34)(H,33,35)(H,36,37)(H,38,39) |
| InChIKey | JFKBRXNPDCFNQP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.30 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|