C29H22N2O6 — CID 2261273
2-benzamido-5-[(4-benzamido-3-carboxyphenyl)methyl]benzoic acid (PubChem CID 2261273) has the molecular formula C29H22N2O6 and a molecular weight of 494.50 g/mol. Its IUPAC name is 2-benzamido-5-[(4-benzamido-3-carboxyphenyl)methyl]benzoic acid.
| Compound Name | 2-benzamido-5-[(4-benzamido-3-carboxyphenyl)methyl]benzoic acid |
|---|---|
| PubChem CID | 2261273 |
| Molecular Formula | C29H22N2O6 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 2-benzamido-5-[(4-benzamido-3-carboxyphenyl)methyl]benzoic acid |
| SMILES | O=C(Nc1ccc(Cc2ccc(NC(=O)c3ccccc3)c(C(=O)O)c2)cc1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C29H22N2O6/c32-26(20-7-3-1-4-8-20)30-24-13-11-18(16-22(24)28(34)35)15-19-12-14-25(23(17-19)29(36)37)31-27(33)21-9-5-2-6-10-21/h1-14,16-17H,15H2,(H,30,32)(H,31,33)(H,34,35)(H,36,37) |
| InChIKey | NFPOMEJEFHTCQD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |