C29H20N4O9 — CID 89242162
5-[[3-formyl-4-[(4-nitrobenzoyl)amino]phenyl]methyl]-2-[(4-nitrobenzoyl)amino]benzoic acid (PubChem CID 89242162) has the molecular formula C29H20N4O9 and a molecular weight of 568.50 g/mol. Its IUPAC name is 5-[[3-formyl-4-[(4-nitrobenzoyl)amino]phenyl]methyl]-2-[(4-nitrobenzoyl)amino]benzoic acid.
| Compound Name | 5-[[3-formyl-4-[(4-nitrobenzoyl)amino]phenyl]methyl]-2-[(4-nitrobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 89242162 |
| Molecular Formula | C29H20N4O9 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | 5-[[3-formyl-4-[(4-nitrobenzoyl)amino]phenyl]methyl]-2-[(4-nitrobenzoyl)amino]benzoic acid |
| SMILES | O=Cc1cc(Cc2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c(C(=O)O)c2)ccc1NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H20N4O9/c34-16-21-14-17(1-11-25(21)30-27(35)19-3-7-22(8-4-19)32(39)40)13-18-2-12-26(24(15-18)29(37)38)31-28(36)20-5-9-23(10-6-20)33(41)42/h1-12,14-16H,13H2,(H,30,35)(H,31,36)(H,37,38) |
| InChIKey | KIGAFTSTWWNCOW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 198.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|