C15H11NO6 — CID 59058024
5-[(4-nitrophenyl)methyl]benzene-1,3-dicarboxylic acid (PubChem CID 59058024) has the molecular formula C15H11NO6 and a molecular weight of 301.25 g/mol. Its IUPAC name is 5-[(4-nitrophenyl)methyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(4-nitrophenyl)methyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 59058024 |
| Molecular Formula | C15H11NO6 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-[(4-nitrophenyl)methyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(Cc2ccc([N+](=O)[O-])cc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C15H11NO6/c17-14(18)11-6-10(7-12(8-11)15(19)20)5-9-1-3-13(4-2-9)16(21)22/h1-4,6-8H,5H2,(H,17,18)(H,19,20) |
| InChIKey | PRLQOCQUNGRWPP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|