C20H15ClN2O7 — CID 71383594
2-[(4-chlorophenyl)methyl]phenol;3,5-dinitrobenzoic acid (PubChem CID 71383594) has the molecular formula C20H15ClN2O7 and a molecular weight of 430.80 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]phenol;3,5-dinitrobenzoic acid.
| Compound Name | 2-[(4-chlorophenyl)methyl]phenol;3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 71383594 |
| Molecular Formula | C20H15ClN2O7 |
| Molecular Weight | 430.80 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]phenol;3,5-dinitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.Oc1ccccc1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H11ClO.C7H4N2O6/c14-12-7-5-10(6-8-12)9-11-3-1-2-4-13(11)15;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-8,15H,9H2;1-3H,(H,10,11) |
| InChIKey | KKHCYFHTSGPSMY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.80 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|