C24H18N2O7 — CID 71387613
3,5-dinitrobenzoic acid;2-(naphthalen-1-ylmethyl)phenol (PubChem CID 71387613) has the molecular formula C24H18N2O7 and a molecular weight of 446.42 g/mol. Its IUPAC name is 3,5-dinitrobenzoic acid;2-(naphthalen-1-ylmethyl)phenol.
| Compound Name | 3,5-dinitrobenzoic acid;2-(naphthalen-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 71387613 |
| Molecular Formula | C24H18N2O7 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 3,5-dinitrobenzoic acid;2-(naphthalen-1-ylmethyl)phenol |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.Oc1ccccc1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C17H14O.C7H4N2O6/c18-17-11-4-2-7-15(17)12-14-9-5-8-13-6-1-3-10-16(13)14;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-11,18H,12H2;1-3H,(H,10,11) |
| InChIKey | JAJVSKTULJBCHQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|