C24H17N3O6 — CID 19165231
N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-3,5-dinitrobenzamide (PubChem CID 19165231) has the molecular formula C24H17N3O6 and a molecular weight of 443.42 g/mol. Its IUPAC name is N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-3,5-dinitrobenzamide.
| Compound Name | N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 19165231 |
| Molecular Formula | C24H17N3O6 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-3,5-dinitrobenzamide |
| SMILES | O=C(NC(c1ccccc1)c1c(O)ccc2ccccc12)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H17N3O6/c28-21-11-10-15-6-4-5-9-20(15)22(21)23(16-7-2-1-3-8-16)25-24(29)17-12-18(26(30)31)14-19(13-17)27(32)33/h1-14,23,28H,(H,25,29) |
| InChIKey | YOCCJKWNRBLWOW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|