C24H18INO2 — CID 19166399
N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-4-iodobenzamide (PubChem CID 19166399) has the molecular formula C24H18INO2 and a molecular weight of 479.32 g/mol. Its IUPAC name is N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-4-iodobenzamide.
| Compound Name | N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 19166399 |
| Molecular Formula | C24H18INO2 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | N-[(2-hydroxynaphthalen-1-yl)-phenylmethyl]-4-iodobenzamide |
| SMILES | O=C(NC(c1ccccc1)c1c(O)ccc2ccccc12)c1ccc(I)cc1 |
| InChI | InChI=1S/C24H18INO2/c25-19-13-10-18(11-14-19)24(28)26-23(17-7-2-1-3-8-17)22-20-9-5-4-6-16(20)12-15-21(22)27/h1-15,23,27H,(H,26,28) |
| InChIKey | BZVRITISBYOYDS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|