C26H23NO4 — CID 71733407
N-[(2,3-dimethoxyphenyl)-(2-hydroxynaphthalen-1-yl)methyl]benzamide (PubChem CID 71733407) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)-(2-hydroxynaphthalen-1-yl)methyl]benzamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)-(2-hydroxynaphthalen-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 71733407 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)-(2-hydroxynaphthalen-1-yl)methyl]benzamide |
| SMILES | COc1cccc(C(NC(=O)c2ccccc2)c2c(O)ccc3ccccc23)c1OC |
| InChI | InChI=1S/C26H23NO4/c1-30-22-14-8-13-20(25(22)31-2)24(27-26(29)18-10-4-3-5-11-18)23-19-12-7-6-9-17(19)15-16-21(23)28/h3-16,24,28H,1-2H3,(H,27,29) |
| InChIKey | QEIHZPKTBYKULG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|