C25H19Cl2NO3 — CID 2897217
N-[(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-3-methoxybenzamide (PubChem CID 2897217) has the molecular formula C25H19Cl2NO3 and a molecular weight of 452.34 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-3-methoxybenzamide.
| Compound Name | N-[(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 2897217 |
| Molecular Formula | C25H19Cl2NO3 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | N-[(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC(c2ccc(Cl)cc2Cl)c2c(O)ccc3ccccc23)c1 |
| InChI | InChI=1S/C25H19Cl2NO3/c1-31-18-7-4-6-16(13-18)25(30)28-24(20-11-10-17(26)14-21(20)27)23-19-8-3-2-5-15(19)9-12-22(23)29/h2-14,24,29H,1H3,(H,28,30) |
| InChIKey | IKVPYGIPLMRMQO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|