C22H21Cl2NO2 — CID 7432415
N-[(S)-(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]pentanamide (PubChem CID 7432415) has the molecular formula C22H21Cl2NO2 and a molecular weight of 402.32 g/mol. Its IUPAC name is N-[(S)-(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]pentanamide.
| Compound Name | N-[(S)-(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 7432415 |
| Molecular Formula | C22H21Cl2NO2 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[(S)-(2,4-dichlorophenyl)-(2-hydroxynaphthalen-1-yl)methyl]pentanamide |
| SMILES | CCCCC(=O)N[C@H](c1ccc(Cl)cc1Cl)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C22H21Cl2NO2/c1-2-3-8-20(27)25-22(17-11-10-15(23)13-18(17)24)21-16-7-5-4-6-14(16)9-12-19(21)26/h4-7,9-13,22,26H,2-3,8H2,1H3,(H,25,27)/t22-/m1/s1 |
| InChIKey | FEVZWMYOBYGFSJ-JOCHJYFZSA-N |
| XLogP | 6.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|