C15H13Cl2NO2 — CID 102367056
N-[(2,4-dichlorophenyl)-(2-hydroxyphenyl)methyl]acetamide (PubChem CID 102367056) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)-(2-hydroxyphenyl)methyl]acetamide.
| Compound Name | N-[(2,4-dichlorophenyl)-(2-hydroxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 102367056 |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | N-[(2,4-dichlorophenyl)-(2-hydroxyphenyl)methyl]acetamide |
| SMILES | CC(=O)NC(c1ccccc1O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2NO2/c1-9(19)18-15(12-4-2-3-5-14(12)20)11-7-6-10(16)8-13(11)17/h2-8,15,20H,1H3,(H,18,19) |
| InChIKey | BQZPRSZUKNCPFK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|