C20H18Cl2N2O2 — CID 1129397
N-[(R)-(2,4-dichlorophenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-methylpropanamide (PubChem CID 1129397) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is N-[(R)-(2,4-dichlorophenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-methylpropanamide.
| Compound Name | N-[(R)-(2,4-dichlorophenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 1129397 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-[(R)-(2,4-dichlorophenyl)-(8-hydroxyquinolin-7-yl)methyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@@H](c1ccc(Cl)cc1Cl)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C20H18Cl2N2O2/c1-11(2)20(26)24-18(14-8-6-13(21)10-16(14)22)15-7-5-12-4-3-9-23-17(12)19(15)25/h3-11,18,25H,1-2H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | GUGJXJDURCSDQV-SFHVURJKSA-N |
| XLogP | 5.11 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|