C22H16Cl2N2O — CID 58543019
7-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]quinolin-8-ol (PubChem CID 58543019) has the molecular formula C22H16Cl2N2O and a molecular weight of 395.29 g/mol. Its IUPAC name is 7-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]quinolin-8-ol.
| Compound Name | 7-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 58543019 |
| Molecular Formula | C22H16Cl2N2O |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 7-[1-(2,4-dichlorophenyl)-2-pyridin-2-ylethyl]quinolin-8-ol |
| SMILES | Oc1c(C(Cc2ccccn2)c2ccc(Cl)cc2Cl)ccc2cccnc12 |
| InChI | InChI=1S/C22H16Cl2N2O/c23-15-7-9-17(20(24)12-15)19(13-16-5-1-2-10-25-16)18-8-6-14-4-3-11-26-21(14)22(18)27/h1-12,19,27H,13H2 |
| InChIKey | MUZMXXQBOJTZSH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |