C22H15ClF2N2O — CID 58542851
7-[2-(4-chloro-2-pyridinyl)-1-(2,4-difluorophenyl)ethyl]quinolin-8-ol (PubChem CID 58542851) has the molecular formula C22H15ClF2N2O and a molecular weight of 396.82 g/mol. Its IUPAC name is 7-[2-(4-chloro-2-pyridinyl)-1-(2,4-difluorophenyl)ethyl]quinolin-8-ol.
| Compound Name | 7-[2-(4-chloro-2-pyridinyl)-1-(2,4-difluorophenyl)ethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 58542851 |
| Molecular Formula | C22H15ClF2N2O |
| Molecular Weight | 396.82 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 7-[2-(4-chloro-2-pyridinyl)-1-(2,4-difluorophenyl)ethyl]quinolin-8-ol |
| SMILES | Oc1c(C(Cc2cc(Cl)ccn2)c2ccc(F)cc2F)ccc2cccnc12 |
| InChI | InChI=1S/C22H15ClF2N2O/c23-14-7-9-26-16(10-14)12-19(17-6-4-15(24)11-20(17)25)18-5-3-13-2-1-8-27-21(13)22(18)28/h1-11,19,28H,12H2 |
| InChIKey | MLDLJMKMMDTWGE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.82 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |