About 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol
7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol (PubChem CID 58542744) has the molecular formula C22H14Cl4N2O
and a molecular weight of 464.18 g/mol. Its IUPAC name is 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol.
Molecular Properties
| Compound Name | 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol |
| PubChem CID | 58542744 |
| Molecular Formula | C22H14Cl4N2O |
| Molecular Weight | 464.18 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol |
| SMILES | Oc1c(C(Cc2cc(Cl)c(Cl)cn2)c2ccc(Cl)cc2Cl)ccc2cccnc12 |
| InChI | InChI=1S/C22H14Cl4N2O/c23-13-4-6-15(18(24)8-13)17(9-14-10-19(25)20(26)11-28-14)16-5-3-12-2-1-7-27-21(12)22(16)29/h1-8,10-11,17,29H,9H2 |
| InChIKey | GDXXKQLUZHJZSO-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.18 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol?
The IUPAC name of 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol (CID 58542744) is 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol.
What is the SMILES notation for 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol?
The canonical SMILES for 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol is Oc1c(C(Cc2cc(Cl)c(Cl)cn2)c2ccc(Cl)cc2Cl)ccc2cccnc12.
What is the InChIKey of 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol?
The InChIKey is GDXXKQLUZHJZSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14Cl4N2O/c23-13-4-6-15(18(24)8-13)17(9-14-10-19(25)20(26)11-28-14)16-5-3-12-2-1-7-27-21(12)22(16)29/h1-8,10-11,17,29H,9H2.
What are the key properties of 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol?
7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol has a molecular weight of 464.18 g/mol, XLogP of 7.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[1-(2,4-dichlorophenyl)-2-(4,5-dichloro-2-pyridinyl)ethyl]quinolin-8-ol is sourced from PubChem (CID 58542744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).