C17H14Cl2N2O — CID 146475110
7-[(2,4-dichlorophenyl)-(methylamino)methyl]quinolin-8-ol (PubChem CID 146475110) has the molecular formula C17H14Cl2N2O and a molecular weight of 333.22 g/mol. Its IUPAC name is 7-[(2,4-dichlorophenyl)-(methylamino)methyl]quinolin-8-ol.
| Compound Name | 7-[(2,4-dichlorophenyl)-(methylamino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 146475110 |
| Molecular Formula | C17H14Cl2N2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 7-[(2,4-dichlorophenyl)-(methylamino)methyl]quinolin-8-ol |
| SMILES | CNC(c1ccc(Cl)cc1Cl)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C17H14Cl2N2O/c1-20-16(12-7-5-11(18)9-14(12)19)13-6-4-10-3-2-8-21-15(10)17(13)22/h2-9,16,20,22H,1H3 |
| InChIKey | QDVDPTJSAXYICN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|