C21H14Cl2FN3O — CID 58543055
7-[(2,5-dichlorophenyl)-[(5-fluoro-2-pyridinyl)amino]methyl]quinolin-8-ol (PubChem CID 58543055) has the molecular formula C21H14Cl2FN3O and a molecular weight of 414.27 g/mol. Its IUPAC name is 7-[(2,5-dichlorophenyl)-[(5-fluoro-2-pyridinyl)amino]methyl]quinolin-8-ol.
| Compound Name | 7-[(2,5-dichlorophenyl)-[(5-fluoro-2-pyridinyl)amino]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 58543055 |
| Molecular Formula | C21H14Cl2FN3O |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 7-[(2,5-dichlorophenyl)-[(5-fluoro-2-pyridinyl)amino]methyl]quinolin-8-ol |
| SMILES | Oc1c(C(Nc2ccc(F)cn2)c2cc(Cl)ccc2Cl)ccc2cccnc12 |
| InChI | InChI=1S/C21H14Cl2FN3O/c22-13-4-7-17(23)16(10-13)20(27-18-8-5-14(24)11-26-18)15-6-3-12-2-1-9-25-19(12)21(15)28/h1-11,20,28H,(H,26,27) |
| InChIKey | WASBBZKEUSUYAC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|