C22H16Cl2FN3O — CID 58543096
7-[(2-chloro-6-fluorophenyl)-[(5-chloro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol (PubChem CID 58543096) has the molecular formula C22H16Cl2FN3O and a molecular weight of 428.29 g/mol. Its IUPAC name is 7-[(2-chloro-6-fluorophenyl)-[(5-chloro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol.
| Compound Name | 7-[(2-chloro-6-fluorophenyl)-[(5-chloro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 58543096 |
| Molecular Formula | C22H16Cl2FN3O |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 7-[(2-chloro-6-fluorophenyl)-[(5-chloro-4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol |
| SMILES | Cc1cc(NC(c2ccc3cccnc3c2O)c2c(F)cccc2Cl)ncc1Cl |
| InChI | InChI=1S/C22H16Cl2FN3O/c1-12-10-18(27-11-16(12)24)28-21(19-15(23)5-2-6-17(19)25)14-8-7-13-4-3-9-26-20(13)22(14)29/h2-11,21,29H,1H3,(H,27,28) |
| InChIKey | PNAUIUDAQFYZCG-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|