C22H18Cl2N3O+ — CID 7031422
7-[(R)-(2,6-dichlorophenyl)-[(4-methylpyridin-1-ium-2-yl)amino]methyl]quinolin-8-ol (PubChem CID 7031422) has the molecular formula C22H18Cl2N3O+ and a molecular weight of 411.31 g/mol. Its IUPAC name is 7-[(R)-(2,6-dichlorophenyl)-[(4-methylpyridin-1-ium-2-yl)amino]methyl]quinolin-8-ol.
| Compound Name | 7-[(R)-(2,6-dichlorophenyl)-[(4-methylpyridin-1-ium-2-yl)amino]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 7031422 |
| Molecular Formula | C22H18Cl2N3O+ |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 7-[(R)-(2,6-dichlorophenyl)-[(4-methylpyridin-1-ium-2-yl)amino]methyl]quinolin-8-ol |
| SMILES | Cc1cc[nH+]c(N[C@H](c2ccc3cccnc3c2O)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C22H17Cl2N3O/c1-13-9-11-25-18(12-13)27-21(19-16(23)5-2-6-17(19)24)15-8-7-14-4-3-10-26-20(14)22(15)28/h2-12,21,28H,1H3,(H,25,27)/p+1/t21-/m1/s1 |
| InChIKey | LNQAUBSYKUMDRN-OAQYLSRUSA-O |
| XLogP | 5.57 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|