C21H20N4O+2 — CID 3642270
7-[[(6-methylpyridin-1-ium-2-yl)amino]-pyridin-1-ium-4-ylmethyl]quinolin-8-ol (PubChem CID 3642270) has the molecular formula C21H20N4O+2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 7-[[(6-methylpyridin-1-ium-2-yl)amino]-pyridin-1-ium-4-ylmethyl]quinolin-8-ol.
| Compound Name | 7-[[(6-methylpyridin-1-ium-2-yl)amino]-pyridin-1-ium-4-ylmethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 3642270 |
| Molecular Formula | C21H20N4O+2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 7-[[(6-methylpyridin-1-ium-2-yl)amino]-pyridin-1-ium-4-ylmethyl]quinolin-8-ol |
| SMILES | Cc1cccc(NC(c2cc[nH+]cc2)c2ccc3cccnc3c2O)[nH+]1 |
| InChI | InChI=1S/C21H18N4O/c1-14-4-2-6-18(24-14)25-19(16-9-12-22-13-10-16)17-8-7-15-5-3-11-23-20(15)21(17)26/h2-13,19,26H,1H3,(H,24,25)/p+2 |
| InChIKey | STROMGIFIYNBGS-UHFFFAOYSA-P |
| XLogP | 3.08 |
| TPSA | 73.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|