C22H19FN3O+ — CID 7012652
7-[(S)-(3-fluorophenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]quinolin-8-ol (PubChem CID 7012652) has the molecular formula C22H19FN3O+ and a molecular weight of 360.41 g/mol. Its IUPAC name is 7-[(S)-(3-fluorophenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]quinolin-8-ol.
| Compound Name | 7-[(S)-(3-fluorophenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 7012652 |
| Molecular Formula | C22H19FN3O+ |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 7-[(S)-(3-fluorophenyl)-[(6-methylpyridin-1-ium-2-yl)amino]methyl]quinolin-8-ol |
| SMILES | Cc1cccc(N[C@@H](c2cccc(F)c2)c2ccc3cccnc3c2O)[nH+]1 |
| InChI | InChI=1S/C22H18FN3O/c1-14-5-2-9-19(25-14)26-20(16-6-3-8-17(23)13-16)18-11-10-15-7-4-12-24-21(15)22(18)27/h2-13,20,27H,1H3,(H,25,26)/p+1/t20-/m0/s1 |
| InChIKey | XKFLXZSCIQRNTM-FQEVSTJZSA-O |
| XLogP | 4.40 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|